C25H30ClN5O — CID 127024893
N,N-dimethyl-3-[(E)-[6-(pyrrolidin-1-ylmethyl)indeno[1,2-b]quinoxalin-11-ylidene]amino]oxypropan-1-amine;hydrochloride (PubChem CID 127024893) has the molecular formula C25H30ClN5O and a molecular weight of 452.00 g/mol. Its IUPAC name is N,N-dimethyl-3-[(E)-[6-(pyrrolidin-1-ylmethyl)indeno[1,2-b]quinoxalin-11-ylidene]amino]oxypropan-1-amine;hydrochloride.
| Compound Name | N,N-dimethyl-3-[(E)-[6-(pyrrolidin-1-ylmethyl)indeno[1,2-b]quinoxalin-11-ylidene]amino]oxypropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 127024893 |
| Molecular Formula | C25H30ClN5O |
| Molecular Weight | 452.00 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | N,N-dimethyl-3-[(E)-[6-(pyrrolidin-1-ylmethyl)indeno[1,2-b]quinoxalin-11-ylidene]amino]oxypropan-1-amine;hydrochloride |
| SMILES | CN(C)CCCO/N=C1\c2ccccc2-c2nc3c(CN4CCCC4)cccc3nc21.Cl |
| InChI | InChI=1S/C25H29N5O.ClH/c1-29(2)13-8-16-31-28-24-20-11-4-3-10-19(20)23-25(24)26-21-12-7-9-18(22(21)27-23)17-30-14-5-6-15-30;/h3-4,7,9-12H,5-6,8,13-17H2,1-2H3;1H/b28-24+; |
| InChIKey | JFHQPRAWTQLMKZ-YTGAECEWSA-N |
| XLogP | 4.35 |
| TPSA | 53.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.00 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|