C26H32ClN5O — CID 127024895
N,N-dimethyl-3-[(E)-[6-(piperidin-1-ylmethyl)indeno[1,2-b]quinoxalin-11-ylidene]amino]oxypropan-1-amine;hydrochloride (PubChem CID 127024895) has the molecular formula C26H32ClN5O and a molecular weight of 466.03 g/mol. Its IUPAC name is N,N-dimethyl-3-[(E)-[6-(piperidin-1-ylmethyl)indeno[1,2-b]quinoxalin-11-ylidene]amino]oxypropan-1-amine;hydrochloride.
| Compound Name | N,N-dimethyl-3-[(E)-[6-(piperidin-1-ylmethyl)indeno[1,2-b]quinoxalin-11-ylidene]amino]oxypropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 127024895 |
| Molecular Formula | C26H32ClN5O |
| Molecular Weight | 466.03 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | N,N-dimethyl-3-[(E)-[6-(piperidin-1-ylmethyl)indeno[1,2-b]quinoxalin-11-ylidene]amino]oxypropan-1-amine;hydrochloride |
| SMILES | CN(C)CCCO/N=C1\c2ccccc2-c2nc3c(CN4CCCCC4)cccc3nc21.Cl |
| InChI | InChI=1S/C26H31N5O.ClH/c1-30(2)14-9-17-32-29-25-21-12-5-4-11-20(21)24-26(25)27-22-13-8-10-19(23(22)28-24)18-31-15-6-3-7-16-31;/h4-5,8,10-13H,3,6-7,9,14-18H2,1-2H3;1H/b29-25+; |
| InChIKey | CZUVMKBNASHTIS-DPWCPDSHSA-N |
| XLogP | 4.74 |
| TPSA | 53.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.03 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|