C31H41ClN6O — CID 127024899
N,N-dimethyl-3-[(E)-[6-[(4-piperidin-1-ylpiperidin-1-yl)methyl]indeno[1,2-b]quinoxalin-11-ylidene]amino]oxypropan-1-amine;hydrochloride (PubChem CID 127024899) has the molecular formula C31H41ClN6O and a molecular weight of 549.16 g/mol. Its IUPAC name is N,N-dimethyl-3-[(E)-[6-[(4-piperidin-1-ylpiperidin-1-yl)methyl]indeno[1,2-b]quinoxalin-11-ylidene]amino]oxypropan-1-amine;hydrochloride.
| Compound Name | N,N-dimethyl-3-[(E)-[6-[(4-piperidin-1-ylpiperidin-1-yl)methyl]indeno[1,2-b]quinoxalin-11-ylidene]amino]oxypropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 127024899 |
| Molecular Formula | C31H41ClN6O |
| Molecular Weight | 549.16 g/mol |
| Exact Mass | 548.30 |
| IUPAC Name | N,N-dimethyl-3-[(E)-[6-[(4-piperidin-1-ylpiperidin-1-yl)methyl]indeno[1,2-b]quinoxalin-11-ylidene]amino]oxypropan-1-amine;hydrochloride |
| SMILES | CN(C)CCCO/N=C1\c2ccccc2-c2nc3c(CN4CCC(N5CCCCC5)CC4)cccc3nc21.Cl |
| InChI | InChI=1S/C31H40N6O.ClH/c1-35(2)16-9-21-38-34-30-26-12-5-4-11-25(26)29-31(30)32-27-13-8-10-23(28(27)33-29)22-36-19-14-24(15-20-36)37-17-6-3-7-18-37;/h4-5,8,10-13,24H,3,6-7,9,14-22H2,1-2H3;1H/b34-30+; |
| InChIKey | LTQQWBVQZVKYDZ-HNTAQFSESA-N |
| XLogP | 5.20 |
| TPSA | 57.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.16 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|