C38H51N3O3 — CID 127025119
4-(aminomethyl)-N-[(2S)-1-(octylamino)-1-oxo-3-[4-[(3-phenylphenyl)methoxy]phenyl]propan-2-yl]cyclohexane-1-carboxamide (PubChem CID 127025119) has the molecular formula C38H51N3O3 and a molecular weight of 597.84 g/mol. Its IUPAC name is 4-(aminomethyl)-N-[(2S)-1-(octylamino)-1-oxo-3-[4-[(3-phenylphenyl)methoxy]phenyl]propan-2-yl]cyclohexane-1-carboxamide.
| Compound Name | 4-(aminomethyl)-N-[(2S)-1-(octylamino)-1-oxo-3-[4-[(3-phenylphenyl)methoxy]phenyl]propan-2-yl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 127025119 |
| Molecular Formula | C38H51N3O3 |
| Molecular Weight | 597.84 g/mol |
| Exact Mass | 597.39 |
| IUPAC Name | 4-(aminomethyl)-N-[(2S)-1-(octylamino)-1-oxo-3-[4-[(3-phenylphenyl)methoxy]phenyl]propan-2-yl]cyclohexane-1-carboxamide |
| SMILES | CCCCCCCCNC(=O)[C@H](Cc1ccc(OCc2cccc(-c3ccccc3)c2)cc1)NC(=O)C1CCC(CN)CC1 |
| InChI | InChI=1S/C38H51N3O3/c1-2-3-4-5-6-10-24-40-38(43)36(41-37(42)33-20-16-30(27-39)17-21-33)26-29-18-22-35(23-19-29)44-28-31-12-11-15-34(25-31)32-13-8-7-9-14-32/h7-9,11-15,18-19,22-23,25,30,33,36H,2-6,10,16-17,20-21,24,26-28,39H2,1H3,(H,40,43)(H,41,42)/t30?,33?,36-/m0/s1 |
| InChIKey | LRYNGGMFNCGTJT-XCRUPADXSA-N |
| XLogP | 7.20 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.84 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|