C24H17Cl2FN4S — CID 127025149
6-(2,4-dichlorophenyl)-3-[1-(3-fluoro-4-phenylphenyl)ethyl]-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine (PubChem CID 127025149) has the molecular formula C24H17Cl2FN4S and a molecular weight of 483.40 g/mol. Its IUPAC name is 6-(2,4-dichlorophenyl)-3-[1-(3-fluoro-4-phenylphenyl)ethyl]-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine.
| Compound Name | 6-(2,4-dichlorophenyl)-3-[1-(3-fluoro-4-phenylphenyl)ethyl]-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine |
|---|---|
| PubChem CID | 127025149 |
| Molecular Formula | C24H17Cl2FN4S |
| Molecular Weight | 483.40 g/mol |
| Exact Mass | 482.05 |
| IUPAC Name | 6-(2,4-dichlorophenyl)-3-[1-(3-fluoro-4-phenylphenyl)ethyl]-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine |
| SMILES | CC(c1ccc(-c2ccccc2)c(F)c1)c1nnc2n1N=C(c1ccc(Cl)cc1Cl)CS2 |
| InChI | InChI=1S/C24H17Cl2FN4S/c1-14(16-7-9-18(21(27)11-16)15-5-3-2-4-6-15)23-28-29-24-31(23)30-22(13-32-24)19-10-8-17(25)12-20(19)26/h2-12,14H,13H2,1H3 |
| InChIKey | VTQPJEKBZMDZAB-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.40 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |