C55H94O14 — CID 127025270
[(2S)-2-[8-(2-octylcyclopropyl)octanoyloxy]-3-[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxypropyl] 8-(2-octylcyclopropyl)octanoate (PubChem CID 127025270) has the molecular formula C55H94O14 and a molecular weight of 979.34 g/mol. Its IUPAC name is [(2S)-2-[8-(2-octylcyclopropyl)octanoyloxy]-3-[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxypropyl] 8-(2-octylcyclopropyl)octanoate.
| Compound Name | [(2S)-2-[8-(2-octylcyclopropyl)octanoyloxy]-3-[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxypropyl] 8-(2-octylcyclopropyl)octanoate |
|---|---|
| PubChem CID | 127025270 |
| Molecular Formula | C55H94O14 |
| Molecular Weight | 979.34 g/mol |
| Exact Mass | 978.66 |
| IUPAC Name | [(2S)-2-[8-(2-octylcyclopropyl)octanoyloxy]-3-[(2R,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]oxypropyl] 8-(2-octylcyclopropyl)octanoate |
| SMILES | CCCCCCCCC1CC1CCCCCCCC(=O)OC[C@H](CO[C@@H]1O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O)OC(=O)CCCCCCCC1CC1CCCCCCCC |
| InChI | InChI=1S/C55H94O14/c1-7-9-11-13-17-23-29-44-35-46(44)31-25-19-15-21-27-33-50(60)63-37-48(68-51(61)34-28-22-16-20-26-32-47-36-45(47)30-24-18-14-12-10-8-2)38-64-55-54(67-43(6)59)53(66-42(5)58)52(65-41(4)57)49(69-55)39-62-40(3)56/h44-49,52-55H,7-39H2,1-6H3/t44?,45?,46?,47?,48-,49-,52-,53+,54-,55-/m1/s1 |
| InChIKey | YOSNRKYVQRISHX-RKNPPTIFSA-N |
| XLogP | 11.78 |
| TPSA | 176.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 69 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 979.34 |
| LogP ≤ 5 | 11.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|