C18H31NO4 — CID 127025455
(2E,7E,9E)-6-ethoxy-11-hydroxy-N-(2-hydroxy-2-methylpropyl)dodeca-2,7,9-trienamide (PubChem CID 127025455) has the molecular formula C18H31NO4 and a molecular weight of 325.45 g/mol. Its IUPAC name is (2E,7E,9E)-6-ethoxy-11-hydroxy-N-(2-hydroxy-2-methylpropyl)dodeca-2,7,9-trienamide.
| Compound Name | (2E,7E,9E)-6-ethoxy-11-hydroxy-N-(2-hydroxy-2-methylpropyl)dodeca-2,7,9-trienamide |
|---|---|
| PubChem CID | 127025455 |
| Molecular Formula | C18H31NO4 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.23 |
| IUPAC Name | (2E,7E,9E)-6-ethoxy-11-hydroxy-N-(2-hydroxy-2-methylpropyl)dodeca-2,7,9-trienamide |
| SMILES | CCOC(/C=C/C=C/C(C)O)CC/C=C/C(=O)NCC(C)(C)O |
| InChI | InChI=1S/C18H31NO4/c1-5-23-16(11-7-6-10-15(2)20)12-8-9-13-17(21)19-14-18(3,4)22/h6-7,9-11,13,15-16,20,22H,5,8,12,14H2,1-4H3,(H,19,21)/b10-6+,11-7+,13-9+ |
| InChIKey | QYFDCLLLDJSPJX-KZHHGSSRSA-N |
| XLogP | 2.11 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|