C15H23NO4 — CID 127025457
(2E,6E,8E)-10-hydroxy-N-(2-hydroxy-2-methylpropyl)-5-oxoundeca-2,6,8-trienamide (PubChem CID 127025457) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is (2E,6E,8E)-10-hydroxy-N-(2-hydroxy-2-methylpropyl)-5-oxoundeca-2,6,8-trienamide.
| Compound Name | (2E,6E,8E)-10-hydroxy-N-(2-hydroxy-2-methylpropyl)-5-oxoundeca-2,6,8-trienamide |
|---|---|
| PubChem CID | 127025457 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | (2E,6E,8E)-10-hydroxy-N-(2-hydroxy-2-methylpropyl)-5-oxoundeca-2,6,8-trienamide |
| SMILES | CC(O)/C=C/C=C/C(=O)C/C=C/C(=O)NCC(C)(C)O |
| InChI | InChI=1S/C15H23NO4/c1-12(17)7-4-5-8-13(18)9-6-10-14(19)16-11-15(2,3)20/h4-8,10,12,17,20H,9,11H2,1-3H3,(H,16,19)/b7-4+,8-5+,10-6+ |
| InChIKey | SYVYFQYWWPNZDM-CFTJBZHISA-N |
| XLogP | 0.88 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|