C23H24O7 — CID 127025570
[(2S,4aR,6R,7R,8S,8aR)-7-hydroxy-6-(hydroxymethyl)-2-phenyl-3,4a,6,7,8,8a-hexahydro-2H-pyrano[2,3-b][1,4]dioxin-8-yl] (E)-3-phenylprop-2-enoate (PubChem CID 127025570) has the molecular formula C23H24O7 and a molecular weight of 412.44 g/mol. Its IUPAC name is [(2S,4aR,6R,7R,8S,8aR)-7-hydroxy-6-(hydroxymethyl)-2-phenyl-3,4a,6,7,8,8a-hexahydro-2H-pyrano[2,3-b][1,4]dioxin-8-yl] (E)-3-phenylprop-2-enoate.
| Compound Name | [(2S,4aR,6R,7R,8S,8aR)-7-hydroxy-6-(hydroxymethyl)-2-phenyl-3,4a,6,7,8,8a-hexahydro-2H-pyrano[2,3-b][1,4]dioxin-8-yl] (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 127025570 |
| Molecular Formula | C23H24O7 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | [(2S,4aR,6R,7R,8S,8aR)-7-hydroxy-6-(hydroxymethyl)-2-phenyl-3,4a,6,7,8,8a-hexahydro-2H-pyrano[2,3-b][1,4]dioxin-8-yl] (E)-3-phenylprop-2-enoate |
| SMILES | O=C(/C=C/c1ccccc1)O[C@H]1[C@H](O)[C@@H](CO)O[C@H]2OC[C@H](c3ccccc3)O[C@@H]21 |
| InChI | InChI=1S/C23H24O7/c24-13-17-20(26)21(30-19(25)12-11-15-7-3-1-4-8-15)22-23(29-17)27-14-18(28-22)16-9-5-2-6-10-16/h1-12,17-18,20-24,26H,13-14H2/b12-11+/t17-,18-,20-,21+,22-,23-/m1/s1 |
| InChIKey | JFVMSIQQHMLMPM-NDWRRNHHSA-N |
| XLogP | 1.85 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|