C21H28N4O — CID 127025595
(1E,4E,6E)-1,7-bis[1-(2-methylpropyl)imidazol-2-yl]hepta-1,4,6-trien-3-one (PubChem CID 127025595) has the molecular formula C21H28N4O and a molecular weight of 352.48 g/mol. Its IUPAC name is (1E,4E,6E)-1,7-bis[1-(2-methylpropyl)imidazol-2-yl]hepta-1,4,6-trien-3-one.
| Compound Name | (1E,4E,6E)-1,7-bis[1-(2-methylpropyl)imidazol-2-yl]hepta-1,4,6-trien-3-one |
|---|---|
| PubChem CID | 127025595 |
| Molecular Formula | C21H28N4O |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.23 |
| IUPAC Name | (1E,4E,6E)-1,7-bis[1-(2-methylpropyl)imidazol-2-yl]hepta-1,4,6-trien-3-one |
| SMILES | CC(C)Cn1ccnc1/C=C/C=C/C(=O)/C=C/c1nccn1CC(C)C |
| InChI | InChI=1S/C21H28N4O/c1-17(2)15-24-13-11-22-20(24)8-6-5-7-19(26)9-10-21-23-12-14-25(21)16-18(3)4/h5-14,17-18H,15-16H2,1-4H3/b7-5+,8-6+,10-9+ |
| InChIKey | BQMVEEOALLXJRC-BISOHRNISA-N |
| XLogP | 4.24 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|