C22H21F3N8O4 — CID 127025644
2,2,2-trifluoroethyl N-[3-[4-(5-amino-3-pyridin-2-yl-1,2,4-triazol-1-yl)-7-methoxyquinazolin-6-yl]oxypropyl]carbamate (PubChem CID 127025644) has the molecular formula C22H21F3N8O4 and a molecular weight of 518.46 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl N-[3-[4-(5-amino-3-pyridin-2-yl-1,2,4-triazol-1-yl)-7-methoxyquinazolin-6-yl]oxypropyl]carbamate.
| Compound Name | 2,2,2-trifluoroethyl N-[3-[4-(5-amino-3-pyridin-2-yl-1,2,4-triazol-1-yl)-7-methoxyquinazolin-6-yl]oxypropyl]carbamate |
|---|---|
| PubChem CID | 127025644 |
| Molecular Formula | C22H21F3N8O4 |
| Molecular Weight | 518.46 g/mol |
| Exact Mass | 518.16 |
| IUPAC Name | 2,2,2-trifluoroethyl N-[3-[4-(5-amino-3-pyridin-2-yl-1,2,4-triazol-1-yl)-7-methoxyquinazolin-6-yl]oxypropyl]carbamate |
| SMILES | COc1cc2ncnc(-n3nc(-c4ccccn4)nc3N)c2cc1OCCCNC(=O)OCC(F)(F)F |
| InChI | InChI=1S/C22H21F3N8O4/c1-35-16-10-15-13(9-17(16)36-8-4-7-28-21(34)37-11-22(23,24)25)19(30-12-29-15)33-20(26)31-18(32-33)14-5-2-3-6-27-14/h2-3,5-6,9-10,12H,4,7-8,11H2,1H3,(H,28,34)(H2,26,31,32) |
| InChIKey | MKCDZLJKLKVBFT-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 152.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.46 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|