C12H10Cl3FN2O2S — CID 127025657
2,2,2-trichloroethyl N-[(1R)-1-(6-fluoro-1,3-benzothiazol-2-yl)ethyl]carbamate (PubChem CID 127025657) has the molecular formula C12H10Cl3FN2O2S and a molecular weight of 371.65 g/mol. Its IUPAC name is 2,2,2-trichloroethyl N-[(1R)-1-(6-fluoro-1,3-benzothiazol-2-yl)ethyl]carbamate.
| Compound Name | 2,2,2-trichloroethyl N-[(1R)-1-(6-fluoro-1,3-benzothiazol-2-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 127025657 |
| Molecular Formula | C12H10Cl3FN2O2S |
| Molecular Weight | 371.65 g/mol |
| Exact Mass | 369.95 |
| IUPAC Name | 2,2,2-trichloroethyl N-[(1R)-1-(6-fluoro-1,3-benzothiazol-2-yl)ethyl]carbamate |
| SMILES | C[C@@H](NC(=O)OCC(Cl)(Cl)Cl)c1nc2ccc(F)cc2s1 |
| InChI | InChI=1S/C12H10Cl3FN2O2S/c1-6(17-11(19)20-5-12(13,14)15)10-18-8-3-2-7(16)4-9(8)21-10/h2-4,6H,5H2,1H3,(H,17,19)/t6-/m1/s1 |
| InChIKey | UFQJJHFCVICJPI-ZCFIWIBFSA-N |
| XLogP | 4.59 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.65 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|