About 9H-pyrido[2,3-b]indol-3-ylmethanol
9H-pyrido[2,3-b]indol-3-ylmethanol (PubChem CID 127025661) has the molecular formula C12H10N2O
and a molecular weight of 198.22 g/mol. Its IUPAC name is 9H-pyrido[2,3-b]indol-3-ylmethanol.
Molecular Properties
| Compound Name | 9H-pyrido[2,3-b]indol-3-ylmethanol |
| PubChem CID | 127025661 |
| Molecular Formula | C12H10N2O |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 9H-pyrido[2,3-b]indol-3-ylmethanol |
| SMILES | OCc1cnc2[nH]c3ccccc3c2c1 |
| InChI | InChI=1S/C12H10N2O/c15-7-8-5-10-9-3-1-2-4-11(9)14-12(10)13-6-8/h1-6,15H,7H2,(H,13,14) |
| InChIKey | QQRGCTHCBOUQJU-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9H-pyrido[2,3-b]indol-3-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-pyrido[2,3-b]indol-3-ylmethanol?
The IUPAC name of 9H-pyrido[2,3-b]indol-3-ylmethanol (CID 127025661) is 9H-pyrido[2,3-b]indol-3-ylmethanol.
What is the SMILES notation for 9H-pyrido[2,3-b]indol-3-ylmethanol?
The canonical SMILES for 9H-pyrido[2,3-b]indol-3-ylmethanol is OCc1cnc2[nH]c3ccccc3c2c1.
What is the InChIKey of 9H-pyrido[2,3-b]indol-3-ylmethanol?
The InChIKey is QQRGCTHCBOUQJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10N2O/c15-7-8-5-10-9-3-1-2-4-11(9)14-12(10)13-6-8/h1-6,15H,7H2,(H,13,14).
What are the key properties of 9H-pyrido[2,3-b]indol-3-ylmethanol?
9H-pyrido[2,3-b]indol-3-ylmethanol has a molecular weight of 198.22 g/mol, XLogP of 2.21, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-pyrido[2,3-b]indol-3-ylmethanol is sourced from PubChem (CID 127025661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).