C34H42N6O4 — CID 127025905
(4aS,8aR)-2-cycloheptyl-4-[4-methoxy-3-[4-[4-(2-methyltetrazol-5-yl)phenoxy]butoxy]phenyl]-4a,5,8,8a-tetrahydrophthalazin-1-one (PubChem CID 127025905) has the molecular formula C34H42N6O4 and a molecular weight of 598.75 g/mol. Its IUPAC name is (4aS,8aR)-2-cycloheptyl-4-[4-methoxy-3-[4-[4-(2-methyltetrazol-5-yl)phenoxy]butoxy]phenyl]-4a,5,8,8a-tetrahydrophthalazin-1-one.
| Compound Name | (4aS,8aR)-2-cycloheptyl-4-[4-methoxy-3-[4-[4-(2-methyltetrazol-5-yl)phenoxy]butoxy]phenyl]-4a,5,8,8a-tetrahydrophthalazin-1-one |
|---|---|
| PubChem CID | 127025905 |
| Molecular Formula | C34H42N6O4 |
| Molecular Weight | 598.75 g/mol |
| Exact Mass | 598.33 |
| IUPAC Name | (4aS,8aR)-2-cycloheptyl-4-[4-methoxy-3-[4-[4-(2-methyltetrazol-5-yl)phenoxy]butoxy]phenyl]-4a,5,8,8a-tetrahydrophthalazin-1-one |
| SMILES | COc1ccc(C2=NN(C3CCCCCC3)C(=O)[C@@H]3CC=CC[C@H]23)cc1OCCCCOc1ccc(-c2nnn(C)n2)cc1 |
| InChI | InChI=1S/C34H42N6O4/c1-39-37-33(35-38-39)24-15-18-27(19-16-24)43-21-9-10-22-44-31-23-25(17-20-30(31)42-2)32-28-13-7-8-14-29(28)34(41)40(36-32)26-11-5-3-4-6-12-26/h7-8,15-20,23,26,28-29H,3-6,9-14,21-22H2,1-2H3/t28-,29+/m0/s1 |
| InChIKey | OKHIBGYAOMMETC-URLMMPGGSA-N |
| XLogP | 5.98 |
| TPSA | 103.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.75 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|