C23H26N8O4 — CID 127025921
tert-butyl N-[2-[4-(5-amino-3-pyridin-2-yl-1,2,4-triazol-1-yl)-7-methoxyquinazolin-6-yl]oxyethyl]carbamate (PubChem CID 127025921) has the molecular formula C23H26N8O4 and a molecular weight of 478.51 g/mol. Its IUPAC name is tert-butyl N-[2-[4-(5-amino-3-pyridin-2-yl-1,2,4-triazol-1-yl)-7-methoxyquinazolin-6-yl]oxyethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-(5-amino-3-pyridin-2-yl-1,2,4-triazol-1-yl)-7-methoxyquinazolin-6-yl]oxyethyl]carbamate |
|---|---|
| PubChem CID | 127025921 |
| Molecular Formula | C23H26N8O4 |
| Molecular Weight | 478.51 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | tert-butyl N-[2-[4-(5-amino-3-pyridin-2-yl-1,2,4-triazol-1-yl)-7-methoxyquinazolin-6-yl]oxyethyl]carbamate |
| SMILES | COc1cc2ncnc(-n3nc(-c4ccccn4)nc3N)c2cc1OCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H26N8O4/c1-23(2,3)35-22(32)26-9-10-34-18-11-14-16(12-17(18)33-4)27-13-28-20(14)31-21(24)29-19(30-31)15-7-5-6-8-25-15/h5-8,11-13H,9-10H2,1-4H3,(H,26,32)(H2,24,29,30) |
| InChIKey | XXFHSURYGVPBNJ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 152.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.51 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|