About methyl 9-[(2,4-dichlorophenyl)methyl]pyrido[2,3-b]indole-3-carboxylate
methyl 9-[(2,4-dichlorophenyl)methyl]pyrido[2,3-b]indole-3-carboxylate (PubChem CID 127025994) has the molecular formula C20H14Cl2N2O2
and a molecular weight of 385.25 g/mol. Its IUPAC name is methyl 9-[(2,4-dichlorophenyl)methyl]pyrido[2,3-b]indole-3-carboxylate.
Molecular Properties
| Compound Name | methyl 9-[(2,4-dichlorophenyl)methyl]pyrido[2,3-b]indole-3-carboxylate |
| PubChem CID | 127025994 |
| Molecular Formula | C20H14Cl2N2O2 |
| Molecular Weight | 385.25 g/mol |
| Exact Mass | 384.04 |
| IUPAC Name | methyl 9-[(2,4-dichlorophenyl)methyl]pyrido[2,3-b]indole-3-carboxylate |
| SMILES | COC(=O)c1cnc2c(c1)c1ccccc1n2Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H14Cl2N2O2/c1-26-20(25)13-8-16-15-4-2-3-5-18(15)24(19(16)23-10-13)11-12-6-7-14(21)9-17(12)22/h2-10H,11H2,1H3 |
| InChIKey | FLZXAGUQRUORJA-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 385.25 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 9-[(2,4-dichlorophenyl)methyl]pyrido[2,3-b]indole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 9-[(2,4-dichlorophenyl)methyl]pyrido[2,3-b]indole-3-carboxylate?
The IUPAC name of methyl 9-[(2,4-dichlorophenyl)methyl]pyrido[2,3-b]indole-3-carboxylate (CID 127025994) is methyl 9-[(2,4-dichlorophenyl)methyl]pyrido[2,3-b]indole-3-carboxylate.
What is the SMILES notation for methyl 9-[(2,4-dichlorophenyl)methyl]pyrido[2,3-b]indole-3-carboxylate?
The canonical SMILES for methyl 9-[(2,4-dichlorophenyl)methyl]pyrido[2,3-b]indole-3-carboxylate is COC(=O)c1cnc2c(c1)c1ccccc1n2Cc1ccc(Cl)cc1Cl.
What is the InChIKey of methyl 9-[(2,4-dichlorophenyl)methyl]pyrido[2,3-b]indole-3-carboxylate?
The InChIKey is FLZXAGUQRUORJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14Cl2N2O2/c1-26-20(25)13-8-16-15-4-2-3-5-18(15)24(19(16)23-10-13)11-12-6-7-14(21)9-17(12)22/h2-10H,11H2,1H3.
What are the key properties of methyl 9-[(2,4-dichlorophenyl)methyl]pyrido[2,3-b]indole-3-carboxylate?
methyl 9-[(2,4-dichlorophenyl)methyl]pyrido[2,3-b]indole-3-carboxylate has a molecular weight of 385.25 g/mol, XLogP of 5.33, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 9-[(2,4-dichlorophenyl)methyl]pyrido[2,3-b]indole-3-carboxylate is sourced from PubChem (CID 127025994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).