About [4-[3-(1,1-dioxo-1,4-thiazinan-4-yl)-2-methylpropyl]phenyl]-trimethylsilane
[4-[3-(1,1-dioxo-1,4-thiazinan-4-yl)-2-methylpropyl]phenyl]-trimethylsilane (PubChem CID 127026012) has the molecular formula C17H29NO2SSi
and a molecular weight of 339.58 g/mol. Its IUPAC name is [4-[3-(1,1-dioxo-1,4-thiazinan-4-yl)-2-methylpropyl]phenyl]-trimethylsilane.
Molecular Properties
| Compound Name | [4-[3-(1,1-dioxo-1,4-thiazinan-4-yl)-2-methylpropyl]phenyl]-trimethylsilane |
| PubChem CID | 127026012 |
| Molecular Formula | C17H29NO2SSi |
| Molecular Weight | 339.58 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | [4-[3-(1,1-dioxo-1,4-thiazinan-4-yl)-2-methylpropyl]phenyl]-trimethylsilane |
| SMILES | CC(Cc1ccc([Si](C)(C)C)cc1)CN1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C17H29NO2SSi/c1-15(14-18-9-11-21(19,20)12-10-18)13-16-5-7-17(8-6-16)22(2,3)4/h5-8,15H,9-14H2,1-4H3 |
| InChIKey | BTRUINKZEMKGDS-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.58 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [4-[3-(1,1-dioxo-1,4-thiazinan-4-yl)-2-methylpropyl]phenyl]-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[3-(1,1-dioxo-1,4-thiazinan-4-yl)-2-methylpropyl]phenyl]-trimethylsilane?
The IUPAC name of [4-[3-(1,1-dioxo-1,4-thiazinan-4-yl)-2-methylpropyl]phenyl]-trimethylsilane (CID 127026012) is [4-[3-(1,1-dioxo-1,4-thiazinan-4-yl)-2-methylpropyl]phenyl]-trimethylsilane.
What is the SMILES notation for [4-[3-(1,1-dioxo-1,4-thiazinan-4-yl)-2-methylpropyl]phenyl]-trimethylsilane?
The canonical SMILES for [4-[3-(1,1-dioxo-1,4-thiazinan-4-yl)-2-methylpropyl]phenyl]-trimethylsilane is CC(Cc1ccc([Si](C)(C)C)cc1)CN1CCS(=O)(=O)CC1.
What is the InChIKey of [4-[3-(1,1-dioxo-1,4-thiazinan-4-yl)-2-methylpropyl]phenyl]-trimethylsilane?
The InChIKey is BTRUINKZEMKGDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H29NO2SSi/c1-15(14-18-9-11-21(19,20)12-10-18)13-16-5-7-17(8-6-16)22(2,3)4/h5-8,15H,9-14H2,1-4H3.
What are the key properties of [4-[3-(1,1-dioxo-1,4-thiazinan-4-yl)-2-methylpropyl]phenyl]-trimethylsilane?
[4-[3-(1,1-dioxo-1,4-thiazinan-4-yl)-2-methylpropyl]phenyl]-trimethylsilane has a molecular weight of 339.58 g/mol, XLogP of 2.14, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[3-(1,1-dioxo-1,4-thiazinan-4-yl)-2-methylpropyl]phenyl]-trimethylsilane is sourced from PubChem (CID 127026012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).