C21H17NO5 — CID 127026266
(2R,3R,4S,5R)-N,3,4-trihydroxy-5-[4-(4-phenylbuta-1,3-diynyl)phenyl]oxolane-2-carboxamide (PubChem CID 127026266) has the molecular formula C21H17NO5 and a molecular weight of 363.37 g/mol. Its IUPAC name is (2R,3R,4S,5R)-N,3,4-trihydroxy-5-[4-(4-phenylbuta-1,3-diynyl)phenyl]oxolane-2-carboxamide.
| Compound Name | (2R,3R,4S,5R)-N,3,4-trihydroxy-5-[4-(4-phenylbuta-1,3-diynyl)phenyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 127026266 |
| Molecular Formula | C21H17NO5 |
| Molecular Weight | 363.37 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | (2R,3R,4S,5R)-N,3,4-trihydroxy-5-[4-(4-phenylbuta-1,3-diynyl)phenyl]oxolane-2-carboxamide |
| SMILES | O=C(NO)[C@@H]1O[C@H](c2ccc(C#CC#Cc3ccccc3)cc2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C21H17NO5/c23-17-18(24)20(21(25)22-26)27-19(17)16-12-10-15(11-13-16)9-5-4-8-14-6-2-1-3-7-14/h1-3,6-7,10-13,17-20,23-24,26H,(H,22,25)/t17-,18+,19+,20+/m0/s1 |
| InChIKey | IIUNNOZXDGWVNZ-MTQWCTHYSA-N |
| XLogP | 0.76 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.37 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|