C21H19NO5 — CID 127026269
(2S)-N,3-dihydroxy-2-[(1R)-2-hydroxy-1-[4-(4-phenylbuta-1,3-diynyl)phenyl]ethoxy]propanamide (PubChem CID 127026269) has the molecular formula C21H19NO5 and a molecular weight of 365.39 g/mol. Its IUPAC name is (2S)-N,3-dihydroxy-2-[(1R)-2-hydroxy-1-[4-(4-phenylbuta-1,3-diynyl)phenyl]ethoxy]propanamide.
| Compound Name | (2S)-N,3-dihydroxy-2-[(1R)-2-hydroxy-1-[4-(4-phenylbuta-1,3-diynyl)phenyl]ethoxy]propanamide |
|---|---|
| PubChem CID | 127026269 |
| Molecular Formula | C21H19NO5 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | (2S)-N,3-dihydroxy-2-[(1R)-2-hydroxy-1-[4-(4-phenylbuta-1,3-diynyl)phenyl]ethoxy]propanamide |
| SMILES | O=C(NO)[C@H](CO)O[C@@H](CO)c1ccc(C#CC#Cc2ccccc2)cc1 |
| InChI | InChI=1S/C21H19NO5/c23-14-19(27-20(15-24)21(25)22-26)18-12-10-17(11-13-18)9-5-4-8-16-6-2-1-3-7-16/h1-3,6-7,10-13,19-20,23-24,26H,14-15H2,(H,22,25)/t19-,20-/m0/s1 |
| InChIKey | AKTKVSUFWYZSHQ-PMACEKPBSA-N |
| XLogP | 1.01 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|