C34H30N6O — CID 127026293
(11R)-5-anilino-11-benzyl-8-methyl-4-[(4-phenylphenyl)methyl]-1,3,4,8,10-pentazatricyclo[7.3.0.02,6]dodeca-2,5,9-trien-7-one (PubChem CID 127026293) has the molecular formula C34H30N6O and a molecular weight of 538.66 g/mol. Its IUPAC name is (11R)-5-anilino-11-benzyl-8-methyl-4-[(4-phenylphenyl)methyl]-1,3,4,8,10-pentazatricyclo[7.3.0.02,6]dodeca-2,5,9-trien-7-one.
| Compound Name | (11R)-5-anilino-11-benzyl-8-methyl-4-[(4-phenylphenyl)methyl]-1,3,4,8,10-pentazatricyclo[7.3.0.02,6]dodeca-2,5,9-trien-7-one |
|---|---|
| PubChem CID | 127026293 |
| Molecular Formula | C34H30N6O |
| Molecular Weight | 538.66 g/mol |
| Exact Mass | 538.25 |
| IUPAC Name | (11R)-5-anilino-11-benzyl-8-methyl-4-[(4-phenylphenyl)methyl]-1,3,4,8,10-pentazatricyclo[7.3.0.02,6]dodeca-2,5,9-trien-7-one |
| SMILES | CN1C(=O)c2c(nn(Cc3ccc(-c4ccccc4)cc3)c2Nc2ccccc2)N2C[C@@H](Cc3ccccc3)N=C12 |
| InChI | InChI=1S/C34H30N6O/c1-38-33(41)30-31(35-28-15-9-4-10-16-28)40(22-25-17-19-27(20-18-25)26-13-7-3-8-14-26)37-32(30)39-23-29(36-34(38)39)21-24-11-5-2-6-12-24/h2-20,29,35H,21-23H2,1H3/t29-/m1/s1 |
| InChIKey | UNHAYWZZBSIFFY-GDLZYMKVSA-N |
| XLogP | 6.21 |
| TPSA | 65.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.66 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |