C35H32N6O2 — CID 127026294
(11S)-5-anilino-8-methyl-11-(phenylmethoxymethyl)-4-[(4-phenylphenyl)methyl]-1,3,4,8,10-pentazatricyclo[7.3.0.02,6]dodeca-2,5,9-trien-7-one (PubChem CID 127026294) has the molecular formula C35H32N6O2 and a molecular weight of 568.68 g/mol. Its IUPAC name is (11S)-5-anilino-8-methyl-11-(phenylmethoxymethyl)-4-[(4-phenylphenyl)methyl]-1,3,4,8,10-pentazatricyclo[7.3.0.02,6]dodeca-2,5,9-trien-7-one.
| Compound Name | (11S)-5-anilino-8-methyl-11-(phenylmethoxymethyl)-4-[(4-phenylphenyl)methyl]-1,3,4,8,10-pentazatricyclo[7.3.0.02,6]dodeca-2,5,9-trien-7-one |
|---|---|
| PubChem CID | 127026294 |
| Molecular Formula | C35H32N6O2 |
| Molecular Weight | 568.68 g/mol |
| Exact Mass | 568.26 |
| IUPAC Name | (11S)-5-anilino-8-methyl-11-(phenylmethoxymethyl)-4-[(4-phenylphenyl)methyl]-1,3,4,8,10-pentazatricyclo[7.3.0.02,6]dodeca-2,5,9-trien-7-one |
| SMILES | CN1C(=O)c2c(nn(Cc3ccc(-c4ccccc4)cc3)c2Nc2ccccc2)N2C[C@@H](COCc3ccccc3)N=C12 |
| InChI | InChI=1S/C35H32N6O2/c1-39-34(42)31-32(36-29-15-9-4-10-16-29)41(21-25-17-19-28(20-18-25)27-13-7-3-8-14-27)38-33(31)40-22-30(37-35(39)40)24-43-23-26-11-5-2-6-12-26/h2-20,30,36H,21-24H2,1H3/t30-/m0/s1 |
| InChIKey | HUPIMISAMSZVKV-PMERELPUSA-N |
| XLogP | 6.19 |
| TPSA | 74.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.68 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |