C22H31N3O4 — CID 127026675
4-[2-[(4aS,5R,6R,8aR)-6-hydroxy-5-(hydroxymethyl)-5,8a-dimethyl-2-(1,2,4-triazol-1-ylmethyl)-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]ethyl]-2H-furan-5-one (PubChem CID 127026675) has the molecular formula C22H31N3O4 and a molecular weight of 401.51 g/mol. Its IUPAC name is 4-[2-[(4aS,5R,6R,8aR)-6-hydroxy-5-(hydroxymethyl)-5,8a-dimethyl-2-(1,2,4-triazol-1-ylmethyl)-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]ethyl]-2H-furan-5-one.
| Compound Name | 4-[2-[(4aS,5R,6R,8aR)-6-hydroxy-5-(hydroxymethyl)-5,8a-dimethyl-2-(1,2,4-triazol-1-ylmethyl)-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]ethyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 127026675 |
| Molecular Formula | C22H31N3O4 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.23 |
| IUPAC Name | 4-[2-[(4aS,5R,6R,8aR)-6-hydroxy-5-(hydroxymethyl)-5,8a-dimethyl-2-(1,2,4-triazol-1-ylmethyl)-3,4,4a,6,7,8-hexahydronaphthalen-1-yl]ethyl]-2H-furan-5-one |
| SMILES | C[C@@]1(CO)[C@H](O)CC[C@@]2(C)C(CCC3=CCOC3=O)=C(Cn3cncn3)CC[C@H]12 |
| InChI | InChI=1S/C22H31N3O4/c1-21-9-7-19(27)22(2,12-26)18(21)6-4-16(11-25-14-23-13-24-25)17(21)5-3-15-8-10-29-20(15)28/h8,13-14,18-19,26-27H,3-7,9-12H2,1-2H3/t18-,19+,21-,22-/m0/s1 |
| InChIKey | SQPNYXKJWFGEGA-MXNKGDRCSA-N |
| XLogP | 2.41 |
| TPSA | 97.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|