C11H12ClN — CID 127026744
6-(3-chlorophenyl)-2,3,4,5-tetrahydropyridine (PubChem CID 127026744) has the molecular formula C11H12ClN and a molecular weight of 193.68 g/mol. Its IUPAC name is 6-(3-chlorophenyl)-2,3,4,5-tetrahydropyridine.
| Compound Name | 6-(3-chlorophenyl)-2,3,4,5-tetrahydropyridine |
|---|---|
| PubChem CID | 127026744 |
| Molecular Formula | C11H12ClN |
| Molecular Weight | 193.68 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 6-(3-chlorophenyl)-2,3,4,5-tetrahydropyridine |
| SMILES | Clc1cccc(C2=NCCCC2)c1 |
| InChI | InChI=1S/C11H12ClN/c12-10-5-3-4-9(8-10)11-6-1-2-7-13-11/h3-5,8H,1-2,6-7H2 |
| InChIKey | NJDRDZZUJLQOGS-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.68 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |