C18H28O5 — CID 127026800
ethyl (1S,4S,5S,7S,8R)-7-acetyloxy-8-hydroxy-1-propan-2-ylspiro[4.5]dec-9-ene-4-carboxylate (PubChem CID 127026800) has the molecular formula C18H28O5 and a molecular weight of 324.42 g/mol. Its IUPAC name is ethyl (1S,4S,5S,7S,8R)-7-acetyloxy-8-hydroxy-1-propan-2-ylspiro[4.5]dec-9-ene-4-carboxylate.
| Compound Name | ethyl (1S,4S,5S,7S,8R)-7-acetyloxy-8-hydroxy-1-propan-2-ylspiro[4.5]dec-9-ene-4-carboxylate |
|---|---|
| PubChem CID | 127026800 |
| Molecular Formula | C18H28O5 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | ethyl (1S,4S,5S,7S,8R)-7-acetyloxy-8-hydroxy-1-propan-2-ylspiro[4.5]dec-9-ene-4-carboxylate |
| SMILES | CCOC(=O)[C@H]1CC[C@@H](C(C)C)[C@]12C=C[C@@H](O)[C@@H](OC(C)=O)C2 |
| InChI | InChI=1S/C18H28O5/c1-5-22-17(21)14-7-6-13(11(2)3)18(14)9-8-15(20)16(10-18)23-12(4)19/h8-9,11,13-16,20H,5-7,10H2,1-4H3/t13-,14+,15+,16-,18+/m0/s1 |
| InChIKey | IIKSSXYTYKQNDE-VNIVASGNSA-N |
| XLogP | 2.47 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|