C26H27NO10 — CID 127026839
[(5R,6R,7S,8R,9R)-6,7,8-triacetyloxy-3-naphthalen-2-yl-1,10-dioxa-2-azaspiro[4.5]dec-2-en-9-yl]methyl acetate (PubChem CID 127026839) has the molecular formula C26H27NO10 and a molecular weight of 513.50 g/mol. Its IUPAC name is [(5R,6R,7S,8R,9R)-6,7,8-triacetyloxy-3-naphthalen-2-yl-1,10-dioxa-2-azaspiro[4.5]dec-2-en-9-yl]methyl acetate.
| Compound Name | [(5R,6R,7S,8R,9R)-6,7,8-triacetyloxy-3-naphthalen-2-yl-1,10-dioxa-2-azaspiro[4.5]dec-2-en-9-yl]methyl acetate |
|---|---|
| PubChem CID | 127026839 |
| Molecular Formula | C26H27NO10 |
| Molecular Weight | 513.50 g/mol |
| Exact Mass | 513.16 |
| IUPAC Name | [(5R,6R,7S,8R,9R)-6,7,8-triacetyloxy-3-naphthalen-2-yl-1,10-dioxa-2-azaspiro[4.5]dec-2-en-9-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@]2(CC(c3ccc4ccccc4c3)=NO2)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C26H27NO10/c1-14(28)32-13-22-23(33-15(2)29)24(34-16(3)30)25(35-17(4)31)26(36-22)12-21(27-37-26)20-10-9-18-7-5-6-8-19(18)11-20/h5-11,22-25H,12-13H2,1-4H3/t22-,23-,24+,25-,26-/m1/s1 |
| InChIKey | HATURVJNRRIAJG-WSGIOKLISA-N |
| XLogP | 2.42 |
| TPSA | 136.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.50 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|