C21H22N2O3 — CID 127026859
acetic acid;4-[5-(4-ethylphenyl)furan-2-yl]benzenecarboximidamide (PubChem CID 127026859) has the molecular formula C21H22N2O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is acetic acid;4-[5-(4-ethylphenyl)furan-2-yl]benzenecarboximidamide.
| Compound Name | acetic acid;4-[5-(4-ethylphenyl)furan-2-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 127026859 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | acetic acid;4-[5-(4-ethylphenyl)furan-2-yl]benzenecarboximidamide |
| SMILES | CC(=O)O.[H]/N=C(\N)c1ccc(-c2ccc(-c3ccc(CC)cc3)o2)cc1 |
| InChI | InChI=1S/C19H18N2O.C2H4O2/c1-2-13-3-5-14(6-4-13)17-11-12-18(22-17)15-7-9-16(10-8-15)19(20)21;1-2(3)4/h3-12H,2H2,1H3,(H3,20,21);1H3,(H,3,4) |
| InChIKey | PHZUSARVUFJXTN-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 100.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|