About 5-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methylamino]adamantan-2-one
5-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methylamino]adamantan-2-one (PubChem CID 127026870) has the molecular formula C18H20N2O2S
and a molecular weight of 328.44 g/mol. Its IUPAC name is 5-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methylamino]adamantan-2-one.
Molecular Properties
| Compound Name | 5-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methylamino]adamantan-2-one |
| PubChem CID | 127026870 |
| Molecular Formula | C18H20N2O2S |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 5-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methylamino]adamantan-2-one |
| SMILES | O=C1C2CC3CC1CC(NCc1cc(-c4cccs4)on1)(C3)C2 |
| InChI | InChI=1S/C18H20N2O2S/c21-17-12-4-11-5-13(17)9-18(7-11,8-12)19-10-14-6-15(22-20-14)16-2-1-3-23-16/h1-3,6,11-13,19H,4-5,7-10H2 |
| InChIKey | YDRMKBYAVGAHBQ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methylamino]adamantan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methylamino]adamantan-2-one?
The IUPAC name of 5-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methylamino]adamantan-2-one (CID 127026870) is 5-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methylamino]adamantan-2-one.
What is the SMILES notation for 5-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methylamino]adamantan-2-one?
The canonical SMILES for 5-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methylamino]adamantan-2-one is O=C1C2CC3CC1CC(NCc1cc(-c4cccs4)on1)(C3)C2.
What is the InChIKey of 5-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methylamino]adamantan-2-one?
The InChIKey is YDRMKBYAVGAHBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N2O2S/c21-17-12-4-11-5-13(17)9-18(7-11,8-12)19-10-14-6-15(22-20-14)16-2-1-3-23-16/h1-3,6,11-13,19H,4-5,7-10H2.
What are the key properties of 5-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methylamino]adamantan-2-one?
5-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methylamino]adamantan-2-one has a molecular weight of 328.44 g/mol, XLogP of 3.64, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(5-thiophen-2-yl-1,2-oxazol-3-yl)methylamino]adamantan-2-one is sourced from PubChem (CID 127026870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).