About methyl 9-[(3,5-dimethoxyphenyl)methyl]pyrido[2,3-b]indole-3-carboxylate
methyl 9-[(3,5-dimethoxyphenyl)methyl]pyrido[2,3-b]indole-3-carboxylate (PubChem CID 127026905) has the molecular formula C22H20N2O4
and a molecular weight of 376.41 g/mol. Its IUPAC name is methyl 9-[(3,5-dimethoxyphenyl)methyl]pyrido[2,3-b]indole-3-carboxylate.
Molecular Properties
| Compound Name | methyl 9-[(3,5-dimethoxyphenyl)methyl]pyrido[2,3-b]indole-3-carboxylate |
| PubChem CID | 127026905 |
| Molecular Formula | C22H20N2O4 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | methyl 9-[(3,5-dimethoxyphenyl)methyl]pyrido[2,3-b]indole-3-carboxylate |
| SMILES | COC(=O)c1cnc2c(c1)c1ccccc1n2Cc1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C22H20N2O4/c1-26-16-8-14(9-17(11-16)27-2)13-24-20-7-5-4-6-18(20)19-10-15(22(25)28-3)12-23-21(19)24/h4-12H,13H2,1-3H3 |
| InChIKey | BQVBAMDPSGXQKE-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 62.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 9-[(3,5-dimethoxyphenyl)methyl]pyrido[2,3-b]indole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 9-[(3,5-dimethoxyphenyl)methyl]pyrido[2,3-b]indole-3-carboxylate?
The IUPAC name of methyl 9-[(3,5-dimethoxyphenyl)methyl]pyrido[2,3-b]indole-3-carboxylate (CID 127026905) is methyl 9-[(3,5-dimethoxyphenyl)methyl]pyrido[2,3-b]indole-3-carboxylate.
What is the SMILES notation for methyl 9-[(3,5-dimethoxyphenyl)methyl]pyrido[2,3-b]indole-3-carboxylate?
The canonical SMILES for methyl 9-[(3,5-dimethoxyphenyl)methyl]pyrido[2,3-b]indole-3-carboxylate is COC(=O)c1cnc2c(c1)c1ccccc1n2Cc1cc(OC)cc(OC)c1.
What is the InChIKey of methyl 9-[(3,5-dimethoxyphenyl)methyl]pyrido[2,3-b]indole-3-carboxylate?
The InChIKey is BQVBAMDPSGXQKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20N2O4/c1-26-16-8-14(9-17(11-16)27-2)13-24-20-7-5-4-6-18(20)19-10-15(22(25)28-3)12-23-21(19)24/h4-12H,13H2,1-3H3.
What are the key properties of methyl 9-[(3,5-dimethoxyphenyl)methyl]pyrido[2,3-b]indole-3-carboxylate?
methyl 9-[(3,5-dimethoxyphenyl)methyl]pyrido[2,3-b]indole-3-carboxylate has a molecular weight of 376.41 g/mol, XLogP of 4.04, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 9-[(3,5-dimethoxyphenyl)methyl]pyrido[2,3-b]indole-3-carboxylate is sourced from PubChem (CID 127026905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).