About N-[4-[4-(2-oxo-1,3-dihydroindol-4-yl)piperazin-1-yl]butyl]naphthalene-2-carboxamide
N-[4-[4-(2-oxo-1,3-dihydroindol-4-yl)piperazin-1-yl]butyl]naphthalene-2-carboxamide (PubChem CID 127027079) has the molecular formula C27H30N4O2
and a molecular weight of 442.56 g/mol. Its IUPAC name is N-[4-[4-(2-oxo-1,3-dihydroindol-4-yl)piperazin-1-yl]butyl]naphthalene-2-carboxamide.
Molecular Properties
| Compound Name | N-[4-[4-(2-oxo-1,3-dihydroindol-4-yl)piperazin-1-yl]butyl]naphthalene-2-carboxamide |
| PubChem CID | 127027079 |
| Molecular Formula | C27H30N4O2 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | N-[4-[4-(2-oxo-1,3-dihydroindol-4-yl)piperazin-1-yl]butyl]naphthalene-2-carboxamide |
| SMILES | O=C1Cc2c(cccc2N2CCN(CCCCNC(=O)c3ccc4ccccc4c3)CC2)N1 |
| InChI | InChI=1S/C27H30N4O2/c32-26-19-23-24(29-26)8-5-9-25(23)31-16-14-30(15-17-31)13-4-3-12-28-27(33)22-11-10-20-6-1-2-7-21(20)18-22/h1-2,5-11,18H,3-4,12-17,19H2,(H,28,33)(H,29,32) |
| InChIKey | HSNDKUASWXMOHD-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[4-[4-(2-oxo-1,3-dihydroindol-4-yl)piperazin-1-yl]butyl]naphthalene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[4-(2-oxo-1,3-dihydroindol-4-yl)piperazin-1-yl]butyl]naphthalene-2-carboxamide?
The IUPAC name of N-[4-[4-(2-oxo-1,3-dihydroindol-4-yl)piperazin-1-yl]butyl]naphthalene-2-carboxamide (CID 127027079) is N-[4-[4-(2-oxo-1,3-dihydroindol-4-yl)piperazin-1-yl]butyl]naphthalene-2-carboxamide.
What is the SMILES notation for N-[4-[4-(2-oxo-1,3-dihydroindol-4-yl)piperazin-1-yl]butyl]naphthalene-2-carboxamide?
The canonical SMILES for N-[4-[4-(2-oxo-1,3-dihydroindol-4-yl)piperazin-1-yl]butyl]naphthalene-2-carboxamide is O=C1Cc2c(cccc2N2CCN(CCCCNC(=O)c3ccc4ccccc4c3)CC2)N1.
What is the InChIKey of N-[4-[4-(2-oxo-1,3-dihydroindol-4-yl)piperazin-1-yl]butyl]naphthalene-2-carboxamide?
The InChIKey is HSNDKUASWXMOHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H30N4O2/c32-26-19-23-24(29-26)8-5-9-25(23)31-16-14-30(15-17-31)13-4-3-12-28-27(33)22-11-10-20-6-1-2-7-21(20)18-22/h1-2,5-11,18H,3-4,12-17,19H2,(H,28,33)(H,29,32).
What are the key properties of N-[4-[4-(2-oxo-1,3-dihydroindol-4-yl)piperazin-1-yl]butyl]naphthalene-2-carboxamide?
N-[4-[4-(2-oxo-1,3-dihydroindol-4-yl)piperazin-1-yl]butyl]naphthalene-2-carboxamide has a molecular weight of 442.56 g/mol, XLogP of 3.67, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[4-(2-oxo-1,3-dihydroindol-4-yl)piperazin-1-yl]butyl]naphthalene-2-carboxamide is sourced from PubChem (CID 127027079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).