About N'-(4-bromophenyl)-3,3-difluoro-2-oxo-1H-indole-5-sulfonohydrazide
N'-(4-bromophenyl)-3,3-difluoro-2-oxo-1H-indole-5-sulfonohydrazide (PubChem CID 127027129) has the molecular formula C14H10BrF2N3O3S
and a molecular weight of 418.22 g/mol. Its IUPAC name is N'-(4-bromophenyl)-3,3-difluoro-2-oxo-1H-indole-5-sulfonohydrazide.
Molecular Properties
| Compound Name | N'-(4-bromophenyl)-3,3-difluoro-2-oxo-1H-indole-5-sulfonohydrazide |
| PubChem CID | 127027129 |
| Molecular Formula | C14H10BrF2N3O3S |
| Molecular Weight | 418.22 g/mol |
| Exact Mass | 416.96 |
| IUPAC Name | N'-(4-bromophenyl)-3,3-difluoro-2-oxo-1H-indole-5-sulfonohydrazide |
| SMILES | O=C1Nc2ccc(S(=O)(=O)NNc3ccc(Br)cc3)cc2C1(F)F |
| InChI | InChI=1S/C14H10BrF2N3O3S/c15-8-1-3-9(4-2-8)19-20-24(22,23)10-5-6-12-11(7-10)14(16,17)13(21)18-12/h1-7,19-20H,(H,18,21) |
| InChIKey | INRDSDRIVSDSPB-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.22 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-(4-bromophenyl)-3,3-difluoro-2-oxo-1H-indole-5-sulfonohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(4-bromophenyl)-3,3-difluoro-2-oxo-1H-indole-5-sulfonohydrazide?
The IUPAC name of N'-(4-bromophenyl)-3,3-difluoro-2-oxo-1H-indole-5-sulfonohydrazide (CID 127027129) is N'-(4-bromophenyl)-3,3-difluoro-2-oxo-1H-indole-5-sulfonohydrazide.
What is the SMILES notation for N'-(4-bromophenyl)-3,3-difluoro-2-oxo-1H-indole-5-sulfonohydrazide?
The canonical SMILES for N'-(4-bromophenyl)-3,3-difluoro-2-oxo-1H-indole-5-sulfonohydrazide is O=C1Nc2ccc(S(=O)(=O)NNc3ccc(Br)cc3)cc2C1(F)F.
What is the InChIKey of N'-(4-bromophenyl)-3,3-difluoro-2-oxo-1H-indole-5-sulfonohydrazide?
The InChIKey is INRDSDRIVSDSPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10BrF2N3O3S/c15-8-1-3-9(4-2-8)19-20-24(22,23)10-5-6-12-11(7-10)14(16,17)13(21)18-12/h1-7,19-20H,(H,18,21).
What are the key properties of N'-(4-bromophenyl)-3,3-difluoro-2-oxo-1H-indole-5-sulfonohydrazide?
N'-(4-bromophenyl)-3,3-difluoro-2-oxo-1H-indole-5-sulfonohydrazide has a molecular weight of 418.22 g/mol, XLogP of 2.80, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(4-bromophenyl)-3,3-difluoro-2-oxo-1H-indole-5-sulfonohydrazide is sourced from PubChem (CID 127027129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).