C28H32FN7O — CID 127027161
(11R,15S)-4-[[4-(6-fluoro-2-pyridinyl)phenyl]methyl]-8-methyl-5-(pentan-2-ylamino)-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-7-one (PubChem CID 127027161) has the molecular formula C28H32FN7O and a molecular weight of 501.61 g/mol. Its IUPAC name is (11R,15S)-4-[[4-(6-fluoro-2-pyridinyl)phenyl]methyl]-8-methyl-5-(pentan-2-ylamino)-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-7-one.
| Compound Name | (11R,15S)-4-[[4-(6-fluoro-2-pyridinyl)phenyl]methyl]-8-methyl-5-(pentan-2-ylamino)-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-7-one |
|---|---|
| PubChem CID | 127027161 |
| Molecular Formula | C28H32FN7O |
| Molecular Weight | 501.61 g/mol |
| Exact Mass | 501.27 |
| IUPAC Name | (11R,15S)-4-[[4-(6-fluoro-2-pyridinyl)phenyl]methyl]-8-methyl-5-(pentan-2-ylamino)-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-7-one |
| SMILES | CCCC(C)Nc1c2c(nn1Cc1ccc(-c3cccc(F)n3)cc1)N1C(=N[C@@H]3CCC[C@@H]31)N(C)C2=O |
| InChI | InChI=1S/C28H32FN7O/c1-4-7-17(2)30-25-24-26(36-22-10-5-9-21(22)32-28(36)34(3)27(24)37)33-35(25)16-18-12-14-19(15-13-18)20-8-6-11-23(29)31-20/h6,8,11-15,17,21-22,30H,4-5,7,9-10,16H2,1-3H3/t17?,21-,22+/m1/s1 |
| InChIKey | ZWZLBWWZYMAAHW-RRNUJPESSA-N |
| XLogP | 4.92 |
| TPSA | 78.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.61 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|