C40H35N3O3 — CID 127027176
ethyl (3E,5E)-3,5-bis[(1-benzylindol-3-yl)methylidene]-4-oxopiperidine-1-carboxylate (PubChem CID 127027176) has the molecular formula C40H35N3O3 and a molecular weight of 605.74 g/mol. Its IUPAC name is ethyl (3E,5E)-3,5-bis[(1-benzylindol-3-yl)methylidene]-4-oxopiperidine-1-carboxylate.
| Compound Name | ethyl (3E,5E)-3,5-bis[(1-benzylindol-3-yl)methylidene]-4-oxopiperidine-1-carboxylate |
|---|---|
| PubChem CID | 127027176 |
| Molecular Formula | C40H35N3O3 |
| Molecular Weight | 605.74 g/mol |
| Exact Mass | 605.27 |
| IUPAC Name | ethyl (3E,5E)-3,5-bis[(1-benzylindol-3-yl)methylidene]-4-oxopiperidine-1-carboxylate |
| SMILES | CCOC(=O)N1C/C(=C\c2cn(Cc3ccccc3)c3ccccc23)C(=O)/C(=C/c2cn(Cc3ccccc3)c3ccccc23)C1 |
| InChI | InChI=1S/C40H35N3O3/c1-2-46-40(45)43-27-33(21-31-25-41(23-29-13-5-3-6-14-29)37-19-11-9-17-35(31)37)39(44)34(28-43)22-32-26-42(24-30-15-7-4-8-16-30)38-20-12-10-18-36(32)38/h3-22,25-26H,2,23-24,27-28H2,1H3/b33-21+,34-22+ |
| InChIKey | GNKXZDIFFNVIHL-WXGDAXOSSA-N |
| XLogP | 8.20 |
| TPSA | 56.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.74 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|