C40H33Br2N3O3 — CID 127027185
ethyl (3E,5E)-3,5-bis[[1-[(4-bromophenyl)methyl]indol-3-yl]methylidene]-4-oxopiperidine-1-carboxylate (PubChem CID 127027185) has the molecular formula C40H33Br2N3O3 and a molecular weight of 763.53 g/mol. Its IUPAC name is ethyl (3E,5E)-3,5-bis[[1-[(4-bromophenyl)methyl]indol-3-yl]methylidene]-4-oxopiperidine-1-carboxylate.
| Compound Name | ethyl (3E,5E)-3,5-bis[[1-[(4-bromophenyl)methyl]indol-3-yl]methylidene]-4-oxopiperidine-1-carboxylate |
|---|---|
| PubChem CID | 127027185 |
| Molecular Formula | C40H33Br2N3O3 |
| Molecular Weight | 763.53 g/mol |
| Exact Mass | 761.09 |
| IUPAC Name | ethyl (3E,5E)-3,5-bis[[1-[(4-bromophenyl)methyl]indol-3-yl]methylidene]-4-oxopiperidine-1-carboxylate |
| SMILES | CCOC(=O)N1C/C(=C\c2cn(Cc3ccc(Br)cc3)c3ccccc23)C(=O)/C(=C/c2cn(Cc3ccc(Br)cc3)c3ccccc23)C1 |
| InChI | InChI=1S/C40H33Br2N3O3/c1-2-48-40(47)45-25-31(19-29-23-43(37-9-5-3-7-35(29)37)21-27-11-15-33(41)16-12-27)39(46)32(26-45)20-30-24-44(38-10-6-4-8-36(30)38)22-28-13-17-34(42)18-14-28/h3-20,23-24H,2,21-22,25-26H2,1H3/b31-19+,32-20+ |
| InChIKey | YNVDEAXMIIKBFO-GKTLAHRSSA-N |
| XLogP | 9.73 |
| TPSA | 56.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.53 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|