C23H20N4O2 — CID 127027199
ethyl 2-[4-[(2-pyridin-3-ylquinazolin-4-yl)amino]phenyl]acetate (PubChem CID 127027199) has the molecular formula C23H20N4O2 and a molecular weight of 384.44 g/mol. Its IUPAC name is ethyl 2-[4-[(2-pyridin-3-ylquinazolin-4-yl)amino]phenyl]acetate.
| Compound Name | ethyl 2-[4-[(2-pyridin-3-ylquinazolin-4-yl)amino]phenyl]acetate |
|---|---|
| PubChem CID | 127027199 |
| Molecular Formula | C23H20N4O2 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | ethyl 2-[4-[(2-pyridin-3-ylquinazolin-4-yl)amino]phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(Nc2nc(-c3cccnc3)nc3ccccc23)cc1 |
| InChI | InChI=1S/C23H20N4O2/c1-2-29-21(28)14-16-9-11-18(12-10-16)25-23-19-7-3-4-8-20(19)26-22(27-23)17-6-5-13-24-15-17/h3-13,15H,2,14H2,1H3,(H,25,26,27) |
| InChIKey | TUSMLWZLFUAKOS-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |