About 1-[(1S,2S)-2-hydroxycyclohexyl]-4-(2-hydroxyphenyl)pyridin-2-one
1-[(1S,2S)-2-hydroxycyclohexyl]-4-(2-hydroxyphenyl)pyridin-2-one (PubChem CID 127027339) has the molecular formula C17H19NO3
and a molecular weight of 285.34 g/mol. Its IUPAC name is 1-[(1S,2S)-2-hydroxycyclohexyl]-4-(2-hydroxyphenyl)pyridin-2-one.
Molecular Properties
| Compound Name | 1-[(1S,2S)-2-hydroxycyclohexyl]-4-(2-hydroxyphenyl)pyridin-2-one |
| PubChem CID | 127027339 |
| Molecular Formula | C17H19NO3 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | 1-[(1S,2S)-2-hydroxycyclohexyl]-4-(2-hydroxyphenyl)pyridin-2-one |
| SMILES | O=c1cc(-c2ccccc2O)ccn1[C@H]1CCCC[C@@H]1O |
| InChI | InChI=1S/C17H19NO3/c19-15-7-3-1-5-13(15)12-9-10-18(17(21)11-12)14-6-2-4-8-16(14)20/h1,3,5,7,9-11,14,16,19-20H,2,4,6,8H2/t14-,16-/m0/s1 |
| InChIKey | WEFTZYRQBSYMOH-HOCLYGCPSA-N |
| XLogP | 2.70 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(1S,2S)-2-hydroxycyclohexyl]-4-(2-hydroxyphenyl)pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1S,2S)-2-hydroxycyclohexyl]-4-(2-hydroxyphenyl)pyridin-2-one?
The IUPAC name of 1-[(1S,2S)-2-hydroxycyclohexyl]-4-(2-hydroxyphenyl)pyridin-2-one (CID 127027339) is 1-[(1S,2S)-2-hydroxycyclohexyl]-4-(2-hydroxyphenyl)pyridin-2-one.
What is the SMILES notation for 1-[(1S,2S)-2-hydroxycyclohexyl]-4-(2-hydroxyphenyl)pyridin-2-one?
The canonical SMILES for 1-[(1S,2S)-2-hydroxycyclohexyl]-4-(2-hydroxyphenyl)pyridin-2-one is O=c1cc(-c2ccccc2O)ccn1[C@H]1CCCC[C@@H]1O.
What is the InChIKey of 1-[(1S,2S)-2-hydroxycyclohexyl]-4-(2-hydroxyphenyl)pyridin-2-one?
The InChIKey is WEFTZYRQBSYMOH-HOCLYGCPSA-N. The full InChI is InChI=1S/C17H19NO3/c19-15-7-3-1-5-13(15)12-9-10-18(17(21)11-12)14-6-2-4-8-16(14)20/h1,3,5,7,9-11,14,16,19-20H,2,4,6,8H2/t14-,16-/m0/s1.
What are the key properties of 1-[(1S,2S)-2-hydroxycyclohexyl]-4-(2-hydroxyphenyl)pyridin-2-one?
1-[(1S,2S)-2-hydroxycyclohexyl]-4-(2-hydroxyphenyl)pyridin-2-one has a molecular weight of 285.34 g/mol, XLogP of 2.70, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1S,2S)-2-hydroxycyclohexyl]-4-(2-hydroxyphenyl)pyridin-2-one is sourced from PubChem (CID 127027339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).