C16H20O3 — CID 127027406
(1R,9S,12S,13S,14R)-14-methyl-11-oxatetracyclo[7.7.0.01,12.02,7]hexadeca-2,4,6-triene-13,14-diol (PubChem CID 127027406) has the molecular formula C16H20O3 and a molecular weight of 260.33 g/mol. Its IUPAC name is (1R,9S,12S,13S,14R)-14-methyl-11-oxatetracyclo[7.7.0.01,12.02,7]hexadeca-2,4,6-triene-13,14-diol.
| Compound Name | (1R,9S,12S,13S,14R)-14-methyl-11-oxatetracyclo[7.7.0.01,12.02,7]hexadeca-2,4,6-triene-13,14-diol |
|---|---|
| PubChem CID | 127027406 |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | (1R,9S,12S,13S,14R)-14-methyl-11-oxatetracyclo[7.7.0.01,12.02,7]hexadeca-2,4,6-triene-13,14-diol |
| SMILES | C[C@@]1(O)CC[C@]23c4ccccc4C[C@@H]2CO[C@@H]3[C@@H]1O |
| InChI | InChI=1S/C16H20O3/c1-15(18)6-7-16-11(9-19-14(16)13(15)17)8-10-4-2-3-5-12(10)16/h2-5,11,13-14,17-18H,6-9H2,1H3/t11-,13+,14-,15-,16-/m1/s1 |
| InChIKey | LPFBRNYHOZMNHE-DPZJBDQQSA-N |
| XLogP | 1.40 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |