C16H18O4 — CID 127027408
(2S,3R,5'S,6'R)-5',6'-dihydroxy-1'-methylspiro[1,2-dihydroindene-3,4'-cyclohexene]-2-carboxylic acid (PubChem CID 127027408) has the molecular formula C16H18O4 and a molecular weight of 274.32 g/mol. Its IUPAC name is (2S,3R,5'S,6'R)-5',6'-dihydroxy-1'-methylspiro[1,2-dihydroindene-3,4'-cyclohexene]-2-carboxylic acid.
| Compound Name | (2S,3R,5'S,6'R)-5',6'-dihydroxy-1'-methylspiro[1,2-dihydroindene-3,4'-cyclohexene]-2-carboxylic acid |
|---|---|
| PubChem CID | 127027408 |
| Molecular Formula | C16H18O4 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | (2S,3R,5'S,6'R)-5',6'-dihydroxy-1'-methylspiro[1,2-dihydroindene-3,4'-cyclohexene]-2-carboxylic acid |
| SMILES | CC1=CC[C@@]2(c3ccccc3C[C@@H]2C(=O)O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H18O4/c1-9-6-7-16(14(18)13(9)17)11-5-3-2-4-10(11)8-12(16)15(19)20/h2-6,12-14,17-18H,7-8H2,1H3,(H,19,20)/t12-,13-,14-,16+/m1/s1 |
| InChIKey | UFHRVJOFUGOCHM-KQTLUZQSSA-N |
| XLogP | 1.25 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|