C16H20O4 — CID 127027409
(2S,2'S,3R,3'R,4'S)-2',3'-dihydroxy-4'-methylspiro[1,2-dihydroindene-3,1'-cyclohexane]-2-carboxylic acid (PubChem CID 127027409) has the molecular formula C16H20O4 and a molecular weight of 276.33 g/mol. Its IUPAC name is (2S,2'S,3R,3'R,4'S)-2',3'-dihydroxy-4'-methylspiro[1,2-dihydroindene-3,1'-cyclohexane]-2-carboxylic acid.
| Compound Name | (2S,2'S,3R,3'R,4'S)-2',3'-dihydroxy-4'-methylspiro[1,2-dihydroindene-3,1'-cyclohexane]-2-carboxylic acid |
|---|---|
| PubChem CID | 127027409 |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | (2S,2'S,3R,3'R,4'S)-2',3'-dihydroxy-4'-methylspiro[1,2-dihydroindene-3,1'-cyclohexane]-2-carboxylic acid |
| SMILES | C[C@H]1CC[C@@]2(c3ccccc3C[C@@H]2C(=O)O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H20O4/c1-9-6-7-16(14(18)13(9)17)11-5-3-2-4-10(11)8-12(16)15(19)20/h2-5,9,12-14,17-18H,6-8H2,1H3,(H,19,20)/t9-,12+,13+,14+,16-/m0/s1 |
| InChIKey | MMFDCBHKALYVQN-BNVBPEQPSA-N |
| XLogP | 1.33 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |