About 9-benzylpyrido[2,3-b]indole-3-carboxylic acid
9-benzylpyrido[2,3-b]indole-3-carboxylic acid (PubChem CID 127027465) has the molecular formula C19H14N2O2
and a molecular weight of 302.33 g/mol. Its IUPAC name is 9-benzylpyrido[2,3-b]indole-3-carboxylic acid.
Molecular Properties
| Compound Name | 9-benzylpyrido[2,3-b]indole-3-carboxylic acid |
| PubChem CID | 127027465 |
| Molecular Formula | C19H14N2O2 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 9-benzylpyrido[2,3-b]indole-3-carboxylic acid |
| SMILES | O=C(O)c1cnc2c(c1)c1ccccc1n2Cc1ccccc1 |
| InChI | InChI=1S/C19H14N2O2/c22-19(23)14-10-16-15-8-4-5-9-17(15)21(18(16)20-11-14)12-13-6-2-1-3-7-13/h1-11H,12H2,(H,22,23) |
| InChIKey | QDPBHHXPJALJDG-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 9-benzylpyrido[2,3-b]indole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-benzylpyrido[2,3-b]indole-3-carboxylic acid?
The IUPAC name of 9-benzylpyrido[2,3-b]indole-3-carboxylic acid (CID 127027465) is 9-benzylpyrido[2,3-b]indole-3-carboxylic acid.
What is the SMILES notation for 9-benzylpyrido[2,3-b]indole-3-carboxylic acid?
The canonical SMILES for 9-benzylpyrido[2,3-b]indole-3-carboxylic acid is O=C(O)c1cnc2c(c1)c1ccccc1n2Cc1ccccc1.
What is the InChIKey of 9-benzylpyrido[2,3-b]indole-3-carboxylic acid?
The InChIKey is QDPBHHXPJALJDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14N2O2/c22-19(23)14-10-16-15-8-4-5-9-17(15)21(18(16)20-11-14)12-13-6-2-1-3-7-13/h1-11H,12H2,(H,22,23).
What are the key properties of 9-benzylpyrido[2,3-b]indole-3-carboxylic acid?
9-benzylpyrido[2,3-b]indole-3-carboxylic acid has a molecular weight of 302.33 g/mol, XLogP of 3.94, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-benzylpyrido[2,3-b]indole-3-carboxylic acid is sourced from PubChem (CID 127027465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).