C28H25FN8O — CID 127027474
(11R,15S)-4-[[4-(6-fluoro-2-pyridinyl)phenyl]methyl]-8-methyl-5-(pyridin-4-ylamino)-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-7-one (PubChem CID 127027474) has the molecular formula C28H25FN8O and a molecular weight of 508.56 g/mol. Its IUPAC name is (11R,15S)-4-[[4-(6-fluoro-2-pyridinyl)phenyl]methyl]-8-methyl-5-(pyridin-4-ylamino)-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-7-one.
| Compound Name | (11R,15S)-4-[[4-(6-fluoro-2-pyridinyl)phenyl]methyl]-8-methyl-5-(pyridin-4-ylamino)-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-7-one |
|---|---|
| PubChem CID | 127027474 |
| Molecular Formula | C28H25FN8O |
| Molecular Weight | 508.56 g/mol |
| Exact Mass | 508.21 |
| IUPAC Name | (11R,15S)-4-[[4-(6-fluoro-2-pyridinyl)phenyl]methyl]-8-methyl-5-(pyridin-4-ylamino)-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-7-one |
| SMILES | CN1C(=O)c2c(nn(Cc3ccc(-c4cccc(F)n4)cc3)c2Nc2ccncc2)N2C1=N[C@@H]1CCC[C@@H]12 |
| InChI | InChI=1S/C28H25FN8O/c1-35-27(38)24-25(31-19-12-14-30-15-13-19)36(34-26(24)37-22-6-2-5-21(22)33-28(35)37)16-17-8-10-18(11-9-17)20-4-3-7-23(29)32-20/h3-4,7-15,21-22H,2,5-6,16H2,1H3,(H,30,31)/t21-,22+/m1/s1 |
| InChIKey | DDJSHBKEHPMIMN-YADHBBJMSA-N |
| XLogP | 4.45 |
| TPSA | 91.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.56 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|