C19H27N3O4S — CID 127027680
N-(6-sulfanylhexyl)-3-(3,4,5-trimethoxyphenyl)-1H-pyrazole-5-carboxamide (PubChem CID 127027680) has the molecular formula C19H27N3O4S and a molecular weight of 393.51 g/mol. Its IUPAC name is N-(6-sulfanylhexyl)-3-(3,4,5-trimethoxyphenyl)-1H-pyrazole-5-carboxamide.
| Compound Name | N-(6-sulfanylhexyl)-3-(3,4,5-trimethoxyphenyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 127027680 |
| Molecular Formula | C19H27N3O4S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | N-(6-sulfanylhexyl)-3-(3,4,5-trimethoxyphenyl)-1H-pyrazole-5-carboxamide |
| SMILES | COc1cc(-c2cc(C(=O)NCCCCCCS)[nH]n2)cc(OC)c1OC |
| InChI | InChI=1S/C19H27N3O4S/c1-24-16-10-13(11-17(25-2)18(16)26-3)14-12-15(22-21-14)19(23)20-8-6-4-5-7-9-27/h10-12,27H,4-9H2,1-3H3,(H,20,23)(H,21,22) |
| InChIKey | HIUNIEQHYXYXSL-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 85.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|