C19H16N4OS3 — CID 127027848
2-[5-(1-benzothiophen-2-yl)-1,3,4-oxadiazol-2-yl]ethyl N-(pyridin-3-ylmethyl)carbamodithioate (PubChem CID 127027848) has the molecular formula C19H16N4OS3 and a molecular weight of 412.57 g/mol. Its IUPAC name is 2-[5-(1-benzothiophen-2-yl)-1,3,4-oxadiazol-2-yl]ethyl N-(pyridin-3-ylmethyl)carbamodithioate.
| Compound Name | 2-[5-(1-benzothiophen-2-yl)-1,3,4-oxadiazol-2-yl]ethyl N-(pyridin-3-ylmethyl)carbamodithioate |
|---|---|
| PubChem CID | 127027848 |
| Molecular Formula | C19H16N4OS3 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.05 |
| IUPAC Name | 2-[5-(1-benzothiophen-2-yl)-1,3,4-oxadiazol-2-yl]ethyl N-(pyridin-3-ylmethyl)carbamodithioate |
| SMILES | S=C(NCc1cccnc1)SCCc1nnc(-c2cc3ccccc3s2)o1 |
| InChI | InChI=1S/C19H16N4OS3/c25-19(21-12-13-4-3-8-20-11-13)26-9-7-17-22-23-18(24-17)16-10-14-5-1-2-6-15(14)27-16/h1-6,8,10-11H,7,9,12H2,(H,21,25) |
| InChIKey | NPYJKDZOAZYQRT-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thio_carbam_A(1)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|