About [4-[3-amino-1-(isoquinolin-6-ylamino)-1-oxopropan-2-yl]phenyl] pyridine-3-carboxylate
[4-[3-amino-1-(isoquinolin-6-ylamino)-1-oxopropan-2-yl]phenyl] pyridine-3-carboxylate (PubChem CID 127027885) has the molecular formula C24H20N4O3
and a molecular weight of 412.45 g/mol. Its IUPAC name is [4-[3-amino-1-(isoquinolin-6-ylamino)-1-oxopropan-2-yl]phenyl] pyridine-3-carboxylate.
Molecular Properties
| Compound Name | [4-[3-amino-1-(isoquinolin-6-ylamino)-1-oxopropan-2-yl]phenyl] pyridine-3-carboxylate |
| PubChem CID | 127027885 |
| Molecular Formula | C24H20N4O3 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | [4-[3-amino-1-(isoquinolin-6-ylamino)-1-oxopropan-2-yl]phenyl] pyridine-3-carboxylate |
| SMILES | NCC(C(=O)Nc1ccc2cnccc2c1)c1ccc(OC(=O)c2cccnc2)cc1 |
| InChI | InChI=1S/C24H20N4O3/c25-13-22(23(29)28-20-6-3-18-14-27-11-9-17(18)12-20)16-4-7-21(8-5-16)31-24(30)19-2-1-10-26-15-19/h1-12,14-15,22H,13,25H2,(H,28,29) |
| InChIKey | PSYMRYLDFJWSKX-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[3-amino-1-(isoquinolin-6-ylamino)-1-oxopropan-2-yl]phenyl] pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[3-amino-1-(isoquinolin-6-ylamino)-1-oxopropan-2-yl]phenyl] pyridine-3-carboxylate?
The IUPAC name of [4-[3-amino-1-(isoquinolin-6-ylamino)-1-oxopropan-2-yl]phenyl] pyridine-3-carboxylate (CID 127027885) is [4-[3-amino-1-(isoquinolin-6-ylamino)-1-oxopropan-2-yl]phenyl] pyridine-3-carboxylate.
What is the SMILES notation for [4-[3-amino-1-(isoquinolin-6-ylamino)-1-oxopropan-2-yl]phenyl] pyridine-3-carboxylate?
The canonical SMILES for [4-[3-amino-1-(isoquinolin-6-ylamino)-1-oxopropan-2-yl]phenyl] pyridine-3-carboxylate is NCC(C(=O)Nc1ccc2cnccc2c1)c1ccc(OC(=O)c2cccnc2)cc1.
What is the InChIKey of [4-[3-amino-1-(isoquinolin-6-ylamino)-1-oxopropan-2-yl]phenyl] pyridine-3-carboxylate?
The InChIKey is PSYMRYLDFJWSKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20N4O3/c25-13-22(23(29)28-20-6-3-18-14-27-11-9-17(18)12-20)16-4-7-21(8-5-16)31-24(30)19-2-1-10-26-15-19/h1-12,14-15,22H,13,25H2,(H,28,29).
What are the key properties of [4-[3-amino-1-(isoquinolin-6-ylamino)-1-oxopropan-2-yl]phenyl] pyridine-3-carboxylate?
[4-[3-amino-1-(isoquinolin-6-ylamino)-1-oxopropan-2-yl]phenyl] pyridine-3-carboxylate has a molecular weight of 412.45 g/mol, XLogP of 3.53, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[3-amino-1-(isoquinolin-6-ylamino)-1-oxopropan-2-yl]phenyl] pyridine-3-carboxylate is sourced from PubChem (CID 127027885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).