About 4-[4-[2-(4,5-dimethoxy-2-nitrophenyl)-1-hydroxyethyl]phenyl]benzonitrile
4-[4-[2-(4,5-dimethoxy-2-nitrophenyl)-1-hydroxyethyl]phenyl]benzonitrile (PubChem CID 127027922) has the molecular formula C23H20N2O5
and a molecular weight of 404.42 g/mol. Its IUPAC name is 4-[4-[2-(4,5-dimethoxy-2-nitrophenyl)-1-hydroxyethyl]phenyl]benzonitrile.
Molecular Properties
| Compound Name | 4-[4-[2-(4,5-dimethoxy-2-nitrophenyl)-1-hydroxyethyl]phenyl]benzonitrile |
| PubChem CID | 127027922 |
| Molecular Formula | C23H20N2O5 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | 4-[4-[2-(4,5-dimethoxy-2-nitrophenyl)-1-hydroxyethyl]phenyl]benzonitrile |
| SMILES | COc1cc(CC(O)c2ccc(-c3ccc(C#N)cc3)cc2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C23H20N2O5/c1-29-22-12-19(20(25(27)28)13-23(22)30-2)11-21(26)18-9-7-17(8-10-18)16-5-3-15(14-24)4-6-16/h3-10,12-13,21,26H,11H2,1-2H3 |
| InChIKey | KWUGJHZGSDKKSM-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 105.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-[2-(4,5-dimethoxy-2-nitrophenyl)-1-hydroxyethyl]phenyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[2-(4,5-dimethoxy-2-nitrophenyl)-1-hydroxyethyl]phenyl]benzonitrile?
The IUPAC name of 4-[4-[2-(4,5-dimethoxy-2-nitrophenyl)-1-hydroxyethyl]phenyl]benzonitrile (CID 127027922) is 4-[4-[2-(4,5-dimethoxy-2-nitrophenyl)-1-hydroxyethyl]phenyl]benzonitrile.
What is the SMILES notation for 4-[4-[2-(4,5-dimethoxy-2-nitrophenyl)-1-hydroxyethyl]phenyl]benzonitrile?
The canonical SMILES for 4-[4-[2-(4,5-dimethoxy-2-nitrophenyl)-1-hydroxyethyl]phenyl]benzonitrile is COc1cc(CC(O)c2ccc(-c3ccc(C#N)cc3)cc2)c([N+](=O)[O-])cc1OC.
What is the InChIKey of 4-[4-[2-(4,5-dimethoxy-2-nitrophenyl)-1-hydroxyethyl]phenyl]benzonitrile?
The InChIKey is KWUGJHZGSDKKSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H20N2O5/c1-29-22-12-19(20(25(27)28)13-23(22)30-2)11-21(26)18-9-7-17(8-10-18)16-5-3-15(14-24)4-6-16/h3-10,12-13,21,26H,11H2,1-2H3.
What are the key properties of 4-[4-[2-(4,5-dimethoxy-2-nitrophenyl)-1-hydroxyethyl]phenyl]benzonitrile?
4-[4-[2-(4,5-dimethoxy-2-nitrophenyl)-1-hydroxyethyl]phenyl]benzonitrile has a molecular weight of 404.42 g/mol, XLogP of 4.43, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[2-(4,5-dimethoxy-2-nitrophenyl)-1-hydroxyethyl]phenyl]benzonitrile is sourced from PubChem (CID 127027922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).