C12H12O3 — CID 127027944
(1S,8aR)-7-hydroxy-1,8a-dimethyl-1H-naphthalene-2,6-dione (PubChem CID 127027944) has the molecular formula C12H12O3 and a molecular weight of 204.22 g/mol. Its IUPAC name is (1S,8aR)-7-hydroxy-1,8a-dimethyl-1H-naphthalene-2,6-dione.
| Compound Name | (1S,8aR)-7-hydroxy-1,8a-dimethyl-1H-naphthalene-2,6-dione |
|---|---|
| PubChem CID | 127027944 |
| Molecular Formula | C12H12O3 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | (1S,8aR)-7-hydroxy-1,8a-dimethyl-1H-naphthalene-2,6-dione |
| SMILES | C[C@@H]1C(=O)C=CC2=CC(=O)C(O)=C[C@@]21C |
| InChI | InChI=1S/C12H12O3/c1-7-9(13)4-3-8-5-10(14)11(15)6-12(7,8)2/h3-7,15H,1-2H3/t7-,12-/m1/s1 |
| InChIKey | VLCRZPUGQUYCEU-JMCQJSRRSA-N |
| XLogP | 1.72 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |