C19H27NO7 — CID 127028044
[(2S,4aR,6R,7R,8S,8aR)-7-hydroxy-6-(hydroxymethyl)-2-phenyl-3,4a,6,7,8,8a-hexahydro-2H-pyrano[2,3-b][1,4]dioxin-8-yl] (2R)-2-amino-3-methylbutanoate (PubChem CID 127028044) has the molecular formula C19H27NO7 and a molecular weight of 381.43 g/mol. Its IUPAC name is [(2S,4aR,6R,7R,8S,8aR)-7-hydroxy-6-(hydroxymethyl)-2-phenyl-3,4a,6,7,8,8a-hexahydro-2H-pyrano[2,3-b][1,4]dioxin-8-yl] (2R)-2-amino-3-methylbutanoate.
| Compound Name | [(2S,4aR,6R,7R,8S,8aR)-7-hydroxy-6-(hydroxymethyl)-2-phenyl-3,4a,6,7,8,8a-hexahydro-2H-pyrano[2,3-b][1,4]dioxin-8-yl] (2R)-2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 127028044 |
| Molecular Formula | C19H27NO7 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.18 |
| IUPAC Name | [(2S,4aR,6R,7R,8S,8aR)-7-hydroxy-6-(hydroxymethyl)-2-phenyl-3,4a,6,7,8,8a-hexahydro-2H-pyrano[2,3-b][1,4]dioxin-8-yl] (2R)-2-amino-3-methylbutanoate |
| SMILES | CC(C)[C@@H](N)C(=O)O[C@H]1[C@H](O)[C@@H](CO)O[C@H]2OC[C@H](c3ccccc3)O[C@@H]21 |
| InChI | InChI=1S/C19H27NO7/c1-10(2)14(20)18(23)27-16-15(22)12(8-21)26-19-17(16)25-13(9-24-19)11-6-4-3-5-7-11/h3-7,10,12-17,19,21-22H,8-9,20H2,1-2H3/t12-,13-,14-,15-,16+,17-,19-/m1/s1 |
| InChIKey | VGUWBHGUCAMMKR-ZECFBFNRSA-N |
| XLogP | 0.12 |
| TPSA | 120.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |