C32H40N4O5 — CID 127028050
N-[4-[[6,7-bis(2-methoxyethoxy)quinazolin-4-yl]amino]-2-methylphenyl]adamantane-1-carboxamide (PubChem CID 127028050) has the molecular formula C32H40N4O5 and a molecular weight of 560.70 g/mol. Its IUPAC name is N-[4-[[6,7-bis(2-methoxyethoxy)quinazolin-4-yl]amino]-2-methylphenyl]adamantane-1-carboxamide.
| Compound Name | N-[4-[[6,7-bis(2-methoxyethoxy)quinazolin-4-yl]amino]-2-methylphenyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 127028050 |
| Molecular Formula | C32H40N4O5 |
| Molecular Weight | 560.70 g/mol |
| Exact Mass | 560.30 |
| IUPAC Name | N-[4-[[6,7-bis(2-methoxyethoxy)quinazolin-4-yl]amino]-2-methylphenyl]adamantane-1-carboxamide |
| SMILES | COCCOc1cc2ncnc(Nc3ccc(NC(=O)C45CC6CC(CC(C6)C4)C5)c(C)c3)c2cc1OCCOC |
| InChI | InChI=1S/C32H40N4O5/c1-20-10-24(4-5-26(20)36-31(37)32-16-21-11-22(17-32)13-23(12-21)18-32)35-30-25-14-28(40-8-6-38-2)29(41-9-7-39-3)15-27(25)33-19-34-30/h4-5,10,14-15,19,21-23H,6-9,11-13,16-18H2,1-3H3,(H,36,37)(H,33,34,35) |
| InChIKey | ATEOIYJMIPIXFL-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 103.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.70 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|