About 2-[2-(3,4-dimethoxyphenyl)ethylamino]-5,7-dimethoxychromen-4-one
2-[2-(3,4-dimethoxyphenyl)ethylamino]-5,7-dimethoxychromen-4-one (PubChem CID 127028060) has the molecular formula C21H23NO6
and a molecular weight of 385.42 g/mol. Its IUPAC name is 2-[2-(3,4-dimethoxyphenyl)ethylamino]-5,7-dimethoxychromen-4-one.
Molecular Properties
| Compound Name | 2-[2-(3,4-dimethoxyphenyl)ethylamino]-5,7-dimethoxychromen-4-one |
| PubChem CID | 127028060 |
| Molecular Formula | C21H23NO6 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | 2-[2-(3,4-dimethoxyphenyl)ethylamino]-5,7-dimethoxychromen-4-one |
| SMILES | COc1cc(OC)c2c(=O)cc(NCCc3ccc(OC)c(OC)c3)oc2c1 |
| InChI | InChI=1S/C21H23NO6/c1-24-14-10-18(27-4)21-15(23)12-20(28-19(21)11-14)22-8-7-13-5-6-16(25-2)17(9-13)26-3/h5-6,9-12,22H,7-8H2,1-4H3 |
| InChIKey | XIMPKBGBRDGPHU-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 79.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[2-(3,4-dimethoxyphenyl)ethylamino]-5,7-dimethoxychromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(3,4-dimethoxyphenyl)ethylamino]-5,7-dimethoxychromen-4-one?
The IUPAC name of 2-[2-(3,4-dimethoxyphenyl)ethylamino]-5,7-dimethoxychromen-4-one (CID 127028060) is 2-[2-(3,4-dimethoxyphenyl)ethylamino]-5,7-dimethoxychromen-4-one.
What is the SMILES notation for 2-[2-(3,4-dimethoxyphenyl)ethylamino]-5,7-dimethoxychromen-4-one?
The canonical SMILES for 2-[2-(3,4-dimethoxyphenyl)ethylamino]-5,7-dimethoxychromen-4-one is COc1cc(OC)c2c(=O)cc(NCCc3ccc(OC)c(OC)c3)oc2c1.
What is the InChIKey of 2-[2-(3,4-dimethoxyphenyl)ethylamino]-5,7-dimethoxychromen-4-one?
The InChIKey is XIMPKBGBRDGPHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23NO6/c1-24-14-10-18(27-4)21-15(23)12-20(28-19(21)11-14)22-8-7-13-5-6-16(25-2)17(9-13)26-3/h5-6,9-12,22H,7-8H2,1-4H3.
What are the key properties of 2-[2-(3,4-dimethoxyphenyl)ethylamino]-5,7-dimethoxychromen-4-one?
2-[2-(3,4-dimethoxyphenyl)ethylamino]-5,7-dimethoxychromen-4-one has a molecular weight of 385.42 g/mol, XLogP of 3.48, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(3,4-dimethoxyphenyl)ethylamino]-5,7-dimethoxychromen-4-one is sourced from PubChem (CID 127028060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).