About 3-[3,5-bis(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-6-phenylpyridazine
3-[3,5-bis(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-6-phenylpyridazine (PubChem CID 127028131) has the molecular formula C27H24N4O2
and a molecular weight of 436.52 g/mol. Its IUPAC name is 3-[3,5-bis(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-6-phenylpyridazine.
Molecular Properties
| Compound Name | 3-[3,5-bis(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-6-phenylpyridazine |
| PubChem CID | 127028131 |
| Molecular Formula | C27H24N4O2 |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | 3-[3,5-bis(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-6-phenylpyridazine |
| SMILES | COc1ccc(C2=NN(c3ccc(-c4ccccc4)nn3)C(c3ccc(OC)cc3)C2)cc1 |
| InChI | InChI=1S/C27H24N4O2/c1-32-22-12-8-20(9-13-22)25-18-26(21-10-14-23(33-2)15-11-21)31(30-25)27-17-16-24(28-29-27)19-6-4-3-5-7-19/h3-17,26H,18H2,1-2H3 |
| InChIKey | AEEFYIUPUCPDBR-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 59.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[3,5-bis(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-6-phenylpyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3,5-bis(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-6-phenylpyridazine?
The IUPAC name of 3-[3,5-bis(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-6-phenylpyridazine (CID 127028131) is 3-[3,5-bis(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-6-phenylpyridazine.
What is the SMILES notation for 3-[3,5-bis(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-6-phenylpyridazine?
The canonical SMILES for 3-[3,5-bis(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-6-phenylpyridazine is COc1ccc(C2=NN(c3ccc(-c4ccccc4)nn3)C(c3ccc(OC)cc3)C2)cc1.
What is the InChIKey of 3-[3,5-bis(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-6-phenylpyridazine?
The InChIKey is AEEFYIUPUCPDBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H24N4O2/c1-32-22-12-8-20(9-13-22)25-18-26(21-10-14-23(33-2)15-11-21)31(30-25)27-17-16-24(28-29-27)19-6-4-3-5-7-19/h3-17,26H,18H2,1-2H3.
What are the key properties of 3-[3,5-bis(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-6-phenylpyridazine?
3-[3,5-bis(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-6-phenylpyridazine has a molecular weight of 436.52 g/mol, XLogP of 5.52, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3,5-bis(4-methoxyphenyl)-3,4-dihydropyrazol-2-yl]-6-phenylpyridazine is sourced from PubChem (CID 127028131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).