C28H31N7O — CID 127028159
(11R,15S)-5-anilino-8-methyl-4-[(4-pyrrolidin-2-ylphenyl)methyl]-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-7-one (PubChem CID 127028159) has the molecular formula C28H31N7O and a molecular weight of 481.60 g/mol. Its IUPAC name is (11R,15S)-5-anilino-8-methyl-4-[(4-pyrrolidin-2-ylphenyl)methyl]-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-7-one.
| Compound Name | (11R,15S)-5-anilino-8-methyl-4-[(4-pyrrolidin-2-ylphenyl)methyl]-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-7-one |
|---|---|
| PubChem CID | 127028159 |
| Molecular Formula | C28H31N7O |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.26 |
| IUPAC Name | (11R,15S)-5-anilino-8-methyl-4-[(4-pyrrolidin-2-ylphenyl)methyl]-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-7-one |
| SMILES | CN1C(=O)c2c(nn(Cc3ccc(C4CCCN4)cc3)c2Nc2ccccc2)N2C1=N[C@@H]1CCC[C@@H]12 |
| InChI | InChI=1S/C28H31N7O/c1-33-27(36)24-25(30-20-7-3-2-4-8-20)34(17-18-12-14-19(15-13-18)21-10-6-16-29-21)32-26(24)35-23-11-5-9-22(23)31-28(33)35/h2-4,7-8,12-15,21-23,29-30H,5-6,9-11,16-17H2,1H3/t21?,22-,23+/m1/s1 |
| InChIKey | AADMNWCNQHDIIN-NRSZHQCHSA-N |
| XLogP | 4.28 |
| TPSA | 77.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |